gracecoughlin24 gracecoughlin24

11-01-2024
Mathematics

contestada

In a class of 28 students, 8 play an instrument and 10 play a sport. There are 6 students who play an instrument and also play a sport. What is the probability that a student does not play an instrument given that they play a sport?

Respuesta :

sididhrveidh sididhrveidh

11-01-2024

Answer:

40%

Step-by-step explanation:

just write this answer

Answer Link

Otras preguntas

What’s the area of the sector if possible please answer asap

matmaticaly boyles law is stated PV= or P1V1

Answer the following questions. Make list of the systems of the human body

20% of the area of the Southern hemisphere is land. (b) Work out the ratio of the area of land to the area of water in the Southern hemisphere. (Total for quest

why are the products in the philippines written in english even though tagalog is their original language and other countries are the product is only their own

12. As depicted in the figure below, a stone is projected to a cliff of height h with an initial speed of 42m/s directed at angle = 600 above the horizontal. Th

Consider a hypothetical economy in which households spend $0.50 of each additional dollar they earn and save the remaining $0.50. The following graph shows the

18. A rectangular tables has a length that is expressed as 5x + 6 and a width that is expressed as 2x - 3. Find the a) Area of the table b) Perimeter of the tab

A 650-kg satellite is in a circular orbit about Earth at a height above Earth equal to Earth’s mean radius. Find (a) the satellite’s orbital speed, (b) the per

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2